Material Name: | EMM-37, as made | ||||
Chemical Formula: |
|BDMP| [Si12Al2O28]-ETV BDMP = C12H26N2+2 = 3,3'-Bi[1,1-dimethylpyrrodidinium] = 3-(1,1-dimethylpyrrolidin-1-ium-3-yl)-1,1-dimethylpyrrolidin-1-ium SMILES: C1C(C[N+](C1)(C)C)C2C[N+](CC2)(C)C Images: stick ![]() |
||||
Unit Cell: |
triclinic |
P -1 (# 2) |
|||
a' = 8.8317 Å | b' = 9.6344 Å | c' = 10.6526 Å | |||
α' = 104.410° | β' = 99.800° | γ' = 99.500° | |||
Framework Density: |
16.6 T/1000 Å3 |
|
Channels: |
[001] 10 2.9 x 6.1 <-> [100] 8 3.2 x 5.2 <-> [010] 8 4.2 x 4.5
|
References: |
|||
Kapaca, E., Burton, A., Terefenko, E., Vroman, H., Weston, S. C., Kochersperger, M., Afeworki, M., Paur, C., Koziol, L., Ravikovitch, P., Xu, H., Zou, X., Willhammar, T. | |||
"Small Pore Aluminosilicate EMM-37: Synthesis and Structure Determination using Continuous Rotation Electron Diffraction" | |||
Inorg. Chem., 58, 12854-12858 (2019) DOI: 10.1021/acs.inorgchem.9b01798 |
|
Name and Code derivation: |
|
Exxon-Mobil Material - thirty-seven EMM-37 (tiyrty-seven) ETV |