Material Name: | STA-2 | ||||
Chemical Formula: |
|(DQB+2)3 (H2O)22.5 | [Mg5.4Al30.6P36O144]-SAT DQB+2 = C18H34N2+2 = 1,4-diquinuclidiniumbutane = 1-[4-(1-azoniabicyclo[2.2.2]octan-1-yl)butyl]-1-azoniabicyclo[2.2.2]octane SMILES: C1C[N+]2(CCC1CC2)CCCC[N+]34CCC(CC3)CC4 Images: stick ![]() |
||||
Unit Cell: |
trigonal |
R -3 (# 166) |
|||
a' = 12.7260 Å | b' = 12.7260 Å | c' = 30.9390 Å | |||
α' = 90.000° | β' = 90.000° | γ' = 120.000° | |||
Framework Density: |
16.6 T/1000 Å3 |
|
Channels: |
![]()
|
References: |
|||
Noble, G.W., Wright, P.A. and Kvick, Å. | |||
"The templated synthesis and structure determination by synchrotron microcrystal diffraction of the novel small pore magnesium aluminophosphate STA-2" | |||
J. Chem. Soc., Dalton Trans., , 4485-4490 (1997) |
|
Name and Code derivation: |
|
University of Saint Andrews - two STA-2 (two) SAT |